About tert-butyl pyrrolidine-1-carboxylate;ethane;methanol
tert-butyl pyrrolidine-1-carboxylate;ethane;methanol (PubChem CID 142181784) has the molecular formula C12H27NO3
and a molecular weight of 233.35 g/mol. Its IUPAC name is tert-butyl pyrrolidine-1-carboxylate;ethane;methanol.
Molecular Properties
| Compound Name | tert-butyl pyrrolidine-1-carboxylate;ethane;methanol |
| PubChem CID | 142181784 |
| Molecular Formula | C12H27NO3 |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | tert-butyl pyrrolidine-1-carboxylate;ethane;methanol |
| SMILES | CC.CC(C)(C)OC(=O)N1CCCC1.CO |
| InChI | InChI=1S/C9H17NO2.C2H6.CH4O/c1-9(2,3)12-8(11)10-6-4-5-7-10;2*1-2/h4-7H2,1-3H3;1-2H3;2H,1H3 |
| InChIKey | XLHLEUGCISCUKS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl pyrrolidine-1-carboxylate;ethane;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl pyrrolidine-1-carboxylate;ethane;methanol?
The IUPAC name of tert-butyl pyrrolidine-1-carboxylate;ethane;methanol (CID 142181784) is tert-butyl pyrrolidine-1-carboxylate;ethane;methanol.
What is the SMILES notation for tert-butyl pyrrolidine-1-carboxylate;ethane;methanol?
The canonical SMILES for tert-butyl pyrrolidine-1-carboxylate;ethane;methanol is CC.CC(C)(C)OC(=O)N1CCCC1.CO.
What is the InChIKey of tert-butyl pyrrolidine-1-carboxylate;ethane;methanol?
The InChIKey is XLHLEUGCISCUKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2.C2H6.CH4O/c1-9(2,3)12-8(11)10-6-4-5-7-10;2*1-2/h4-7H2,1-3H3;1-2H3;2H,1H3.
What are the key properties of tert-butyl pyrrolidine-1-carboxylate;ethane;methanol?
tert-butyl pyrrolidine-1-carboxylate;ethane;methanol has a molecular weight of 233.35 g/mol, XLogP of 2.65, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl pyrrolidine-1-carboxylate;ethane;methanol is sourced from PubChem (CID 142181784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).