C13H23NO2 — CID 15418755
tert-butyl (5Z)-2,3,4,7,8,9-hexahydroazonine-1-carboxylate (PubChem CID 15418755) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is tert-butyl (5Z)-2,3,4,7,8,9-hexahydroazonine-1-carboxylate.
| Compound Name | tert-butyl (5Z)-2,3,4,7,8,9-hexahydroazonine-1-carboxylate |
|---|---|
| PubChem CID | 15418755 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | tert-butyl (5Z)-2,3,4,7,8,9-hexahydroazonine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC/C=C\CCC1 |
| InChI | InChI=1S/C13H23NO2/c1-13(2,3)16-12(15)14-10-8-6-4-5-7-9-11-14/h4-5H,6-11H2,1-3H3/b5-4- |
| InChIKey | OIBWVJKAAQEXCF-PLNGDYQASA-N |
| XLogP | 3.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|