About tert-butyl azetidine-1-carboxylate;tetrabutylazanium
tert-butyl azetidine-1-carboxylate;tetrabutylazanium (PubChem CID 162104509) has the molecular formula C24H51N2O2+
and a molecular weight of 399.68 g/mol. Its IUPAC name is tert-butyl azetidine-1-carboxylate;tetrabutylazanium.
Molecular Properties
| Compound Name | tert-butyl azetidine-1-carboxylate;tetrabutylazanium |
| PubChem CID | 162104509 |
| Molecular Formula | C24H51N2O2+ |
| Molecular Weight | 399.68 g/mol |
| Exact Mass | 399.39 |
| IUPAC Name | tert-butyl azetidine-1-carboxylate;tetrabutylazanium |
| SMILES | CC(C)(C)OC(=O)N1CCC1.CCCC[N+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36N.C8H15NO2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-8(2,3)11-7(10)9-5-4-6-9/h5-16H2,1-4H3;4-6H2,1-3H3/q+1; |
| InChIKey | ZFIBKIDBTGDANM-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.68 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl azetidine-1-carboxylate;tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl azetidine-1-carboxylate;tetrabutylazanium?
The IUPAC name of tert-butyl azetidine-1-carboxylate;tetrabutylazanium (CID 162104509) is tert-butyl azetidine-1-carboxylate;tetrabutylazanium.
What is the SMILES notation for tert-butyl azetidine-1-carboxylate;tetrabutylazanium?
The canonical SMILES for tert-butyl azetidine-1-carboxylate;tetrabutylazanium is CC(C)(C)OC(=O)N1CCC1.CCCC[N+](CCCC)(CCCC)CCCC.
What is the InChIKey of tert-butyl azetidine-1-carboxylate;tetrabutylazanium?
The InChIKey is ZFIBKIDBTGDANM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.C8H15NO2/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-8(2,3)11-7(10)9-5-4-6-9/h5-16H2,1-4H3;4-6H2,1-3H3/q+1;.
What are the key properties of tert-butyl azetidine-1-carboxylate;tetrabutylazanium?
tert-butyl azetidine-1-carboxylate;tetrabutylazanium has a molecular weight of 399.68 g/mol, XLogP of 6.63, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl azetidine-1-carboxylate;tetrabutylazanium is sourced from PubChem (CID 162104509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).