C10H21AlN2O2 — CID 154554278
tert-butyl 4-alumanyl-1,4-diazepane-1-carboxylate (PubChem CID 154554278) has the molecular formula C10H21AlN2O2 and a molecular weight of 228.27 g/mol. Its IUPAC name is tert-butyl 4-alumanyl-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-alumanyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 154554278 |
| Molecular Formula | C10H21AlN2O2 |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | tert-butyl 4-alumanyl-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN([AlH2])CC1 |
| InChI | InChI=1S/C10H19N2O2.Al.2H/c1-10(2,3)14-9(13)12-7-4-5-11-6-8-12;;;/h4-8H2,1-3H3;;;/q-1;+1;; |
| InChIKey | HQGZXOVGZFNIIK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |