C12H23BrN2O2 — CID 114293385
tert-butyl 4-(2-bromoethyl)-1,4-diazepane-1-carboxylate (PubChem CID 114293385) has the molecular formula C12H23BrN2O2 and a molecular weight of 307.23 g/mol. Its IUPAC name is tert-butyl 4-(2-bromoethyl)-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(2-bromoethyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 114293385 |
| Molecular Formula | C12H23BrN2O2 |
| Molecular Weight | 307.23 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | tert-butyl 4-(2-bromoethyl)-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(CCBr)CC1 |
| InChI | InChI=1S/C12H23BrN2O2/c1-12(2,3)17-11(16)15-7-4-6-14(8-5-13)9-10-15/h4-10H2,1-3H3 |
| InChIKey | RBOZLEGIWIRDNY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|