C24H40N4O4 — CID 123353310
8-O-tert-butyl 1-O-ethyl 4,11-bis(prop-2-ynyl)-1,4,8,11-tetrazacyclotetradecane-1,8-dicarboxylate (PubChem CID 123353310) has the molecular formula C24H40N4O4 and a molecular weight of 448.61 g/mol. Its IUPAC name is 8-O-tert-butyl 1-O-ethyl 4,11-bis(prop-2-ynyl)-1,4,8,11-tetrazacyclotetradecane-1,8-dicarboxylate.
| Compound Name | 8-O-tert-butyl 1-O-ethyl 4,11-bis(prop-2-ynyl)-1,4,8,11-tetrazacyclotetradecane-1,8-dicarboxylate |
|---|---|
| PubChem CID | 123353310 |
| Molecular Formula | C24H40N4O4 |
| Molecular Weight | 448.61 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 8-O-tert-butyl 1-O-ethyl 4,11-bis(prop-2-ynyl)-1,4,8,11-tetrazacyclotetradecane-1,8-dicarboxylate |
| SMILES | C#CCN1CCCN(C(=O)OC(C)(C)C)CCN(CC#C)CCCN(C(=O)OCC)CC1 |
| InChI | InChI=1S/C24H40N4O4/c1-7-12-25-15-11-17-28(23(30)32-24(4,5)6)21-19-26(13-8-2)14-10-16-27(20-18-25)22(29)31-9-3/h1-2H,9-21H2,3-6H3 |
| InChIKey | WQJLVYBGEPBISC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.61 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|