About ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate
ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate (PubChem CID 143179538) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate |
| PubChem CID | 143179538 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate |
| SMILES | C#CCN1CCN(C(=O)OCCC)CC1.CC |
| InChI | InChI=1S/C11H18N2O2.C2H6/c1-3-5-12-6-8-13(9-7-12)11(14)15-10-4-2;1-2/h1H,4-10H2,2H3;1-2H3 |
| InChIKey | OPUVJMOROVEYDC-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate?
The IUPAC name of ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate (CID 143179538) is ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate.
What is the SMILES notation for ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate?
The canonical SMILES for ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate is C#CCN1CCN(C(=O)OCCC)CC1.CC.
What is the InChIKey of ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate?
The InChIKey is OPUVJMOROVEYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2.C2H6/c1-3-5-12-6-8-13(9-7-12)11(14)15-10-4-2;1-2/h1H,4-10H2,2H3;1-2H3.
What are the key properties of ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate?
ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate has a molecular weight of 240.35 g/mol, XLogP of 1.81, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propyl 4-prop-2-ynylpiperazine-1-carboxylate is sourced from PubChem (CID 143179538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).