C14H25BrN2O6 — CID 134129754
tert-butyl 4-(3-bromopropyl)piperazine-1-carboxylate;oxalic acid (PubChem CID 134129754) has the molecular formula C14H25BrN2O6 and a molecular weight of 397.27 g/mol. Its IUPAC name is tert-butyl 4-(3-bromopropyl)piperazine-1-carboxylate;oxalic acid.
| Compound Name | tert-butyl 4-(3-bromopropyl)piperazine-1-carboxylate;oxalic acid |
|---|---|
| PubChem CID | 134129754 |
| Molecular Formula | C14H25BrN2O6 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | tert-butyl 4-(3-bromopropyl)piperazine-1-carboxylate;oxalic acid |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCBr)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C12H23BrN2O2.C2H2O4/c1-12(2,3)17-11(16)15-9-7-14(8-10-15)6-4-5-13;3-1(4)2(5)6/h4-10H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | PGGGRWVFFKHVIY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|