C13H25BrN2O — CID 80666559
1-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-3,3-dimethylbutan-1-one (PubChem CID 80666559) has the molecular formula C13H25BrN2O and a molecular weight of 305.26 g/mol. Its IUPAC name is 1-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 80666559 |
| Molecular Formula | C13H25BrN2O |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-[4-(2-bromoethyl)-1,4-diazepan-1-yl]-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCCN(CCBr)CC1 |
| InChI | InChI=1S/C13H25BrN2O/c1-13(2,3)11-12(17)16-7-4-6-15(8-5-14)9-10-16/h4-11H2,1-3H3 |
| InChIKey | NIKAHJFMOWRYQJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|