C13H24N2O2 — CID 110738741
1-(4-acetyl-1,4-diazepan-1-yl)-3,3-dimethylbutan-1-one (PubChem CID 110738741) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-(4-acetyl-1,4-diazepan-1-yl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(4-acetyl-1,4-diazepan-1-yl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 110738741 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 1-(4-acetyl-1,4-diazepan-1-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC(=O)N1CCCN(C(=O)CC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H24N2O2/c1-11(16)14-6-5-7-15(9-8-14)12(17)10-13(2,3)4/h5-10H2,1-4H3 |
| InChIKey | BPCANOZSBZPLAI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |