C13H22N2O4 — CID 60699624
5-(4-acetylpiperazin-1-yl)-3,3-dimethyl-5-oxopentanoic acid (PubChem CID 60699624) has the molecular formula C13H22N2O4 and a molecular weight of 270.33 g/mol. Its IUPAC name is 5-(4-acetylpiperazin-1-yl)-3,3-dimethyl-5-oxopentanoic acid.
| Compound Name | 5-(4-acetylpiperazin-1-yl)-3,3-dimethyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 60699624 |
| Molecular Formula | C13H22N2O4 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 5-(4-acetylpiperazin-1-yl)-3,3-dimethyl-5-oxopentanoic acid |
| SMILES | CC(=O)N1CCN(C(=O)CC(C)(C)CC(=O)O)CC1 |
| InChI | InChI=1S/C13H22N2O4/c1-10(16)14-4-6-15(7-5-14)11(17)8-13(2,3)9-12(18)19/h4-9H2,1-3H3,(H,18,19) |
| InChIKey | KROOGUZJSXZCQT-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |