C17H26N2O — CID 110873807
3,3-dimethyl-1-(4-phenyl-1,4-diazepan-1-yl)butan-1-one (PubChem CID 110873807) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 3,3-dimethyl-1-(4-phenyl-1,4-diazepan-1-yl)butan-1-one.
| Compound Name | 3,3-dimethyl-1-(4-phenyl-1,4-diazepan-1-yl)butan-1-one |
|---|---|
| PubChem CID | 110873807 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 3,3-dimethyl-1-(4-phenyl-1,4-diazepan-1-yl)butan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H26N2O/c1-17(2,3)14-16(20)19-11-7-10-18(12-13-19)15-8-5-4-6-9-15/h4-6,8-9H,7,10-14H2,1-3H3 |
| InChIKey | ILAJJAQKDRNPEV-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |