C14H20N2O — CID 110873765
1-(4-phenyl-1,4-diazepan-1-yl)propan-1-one (PubChem CID 110873765) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-(4-phenyl-1,4-diazepan-1-yl)propan-1-one.
| Compound Name | 1-(4-phenyl-1,4-diazepan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 110873765 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 1-(4-phenyl-1,4-diazepan-1-yl)propan-1-one |
| SMILES | CCC(=O)N1CCCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C14H20N2O/c1-2-14(17)16-10-6-9-15(11-12-16)13-7-4-3-5-8-13/h3-5,7-8H,2,6,9-12H2,1H3 |
| InChIKey | KRRYYJHVOFWLSC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |