C16H24N2O — CID 110873769
1-(4-phenyl-1,4-diazepan-1-yl)pentan-1-one (PubChem CID 110873769) has the molecular formula C16H24N2O and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-(4-phenyl-1,4-diazepan-1-yl)pentan-1-one.
| Compound Name | 1-(4-phenyl-1,4-diazepan-1-yl)pentan-1-one |
|---|---|
| PubChem CID | 110873769 |
| Molecular Formula | C16H24N2O |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | 1-(4-phenyl-1,4-diazepan-1-yl)pentan-1-one |
| SMILES | CCCCC(=O)N1CCCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C16H24N2O/c1-2-3-10-16(19)18-12-7-11-17(13-14-18)15-8-5-4-6-9-15/h4-6,8-9H,2-3,7,10-14H2,1H3 |
| InChIKey | OTZGOEYHOYJOQV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |