C26H34N4O2 — CID 2933488
1,6-bis(4-phenylpiperazin-1-yl)hexane-1,6-dione (PubChem CID 2933488) has the molecular formula C26H34N4O2 and a molecular weight of 434.58 g/mol. Its IUPAC name is 1,6-bis(4-phenylpiperazin-1-yl)hexane-1,6-dione.
| Compound Name | 1,6-bis(4-phenylpiperazin-1-yl)hexane-1,6-dione |
|---|---|
| PubChem CID | 2933488 |
| Molecular Formula | C26H34N4O2 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 1,6-bis(4-phenylpiperazin-1-yl)hexane-1,6-dione |
| SMILES | O=C(CCCCC(=O)N1CCN(c2ccccc2)CC1)N1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C26H34N4O2/c31-25(29-19-15-27(16-20-29)23-9-3-1-4-10-23)13-7-8-14-26(32)30-21-17-28(18-22-30)24-11-5-2-6-12-24/h1-6,9-12H,7-8,13-22H2 |
| InChIKey | GAPUQWVSPPGFPQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|