C11H21N3OS — CID 59072038
4-(3,3-dimethylbutanoyl)piperazine-1-carbothioamide (PubChem CID 59072038) has the molecular formula C11H21N3OS and a molecular weight of 243.38 g/mol. Its IUPAC name is 4-(3,3-dimethylbutanoyl)piperazine-1-carbothioamide.
| Compound Name | 4-(3,3-dimethylbutanoyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 59072038 |
| Molecular Formula | C11H21N3OS |
| Molecular Weight | 243.38 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | 4-(3,3-dimethylbutanoyl)piperazine-1-carbothioamide |
| SMILES | CC(C)(C)CC(=O)N1CCN(C(N)=S)CC1 |
| InChI | InChI=1S/C11H21N3OS/c1-11(2,3)8-9(15)13-4-6-14(7-5-13)10(12)16/h4-8H2,1-3H3,(H2,12,16) |
| InChIKey | PRXXTSRJQDXKEF-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|