C10H21N3O — CID 144808257
1-(4-aminopiperazin-1-yl)-3,3-dimethylbutan-1-one (PubChem CID 144808257) has the molecular formula C10H21N3O and a molecular weight of 199.30 g/mol. Its IUPAC name is 1-(4-aminopiperazin-1-yl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(4-aminopiperazin-1-yl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 144808257 |
| Molecular Formula | C10H21N3O |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.17 |
| IUPAC Name | 1-(4-aminopiperazin-1-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CCN(N)CC1 |
| InChI | InChI=1S/C10H21N3O/c1-10(2,3)8-9(14)12-4-6-13(11)7-5-12/h4-8,11H2,1-3H3 |
| InChIKey | FVLIITVEBQASEG-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|