C17H31N3O2 — CID 124877658
1-[(9aR)-2-acetyl-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-3,3-dimethylbutan-1-one (PubChem CID 124877658) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-[(9aR)-2-acetyl-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-3,3-dimethylbutan-1-one.
| Compound Name | 1-[(9aR)-2-acetyl-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 124877658 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | 1-[(9aR)-2-acetyl-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-3,3-dimethylbutan-1-one |
| SMILES | CC(=O)N1C[C@@H]2CN(C(=O)CC(C)(C)C)CCN2C(C)(C)C1 |
| InChI | InChI=1S/C17H31N3O2/c1-13(21)19-11-14-10-18(15(22)9-16(2,3)4)7-8-20(14)17(5,6)12-19/h14H,7-12H2,1-6H3/t14-/m0/s1 |
| InChIKey | UJOWOBCBLOYBEC-AWEZNQCLSA-N |
| XLogP | 1.58 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |