About potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate
potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate (PubChem CID 155707609) has the molecular formula C11H22KNO3
and a molecular weight of 255.40 g/mol. Its IUPAC name is potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate.
Molecular Properties
| Compound Name | potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate |
| PubChem CID | 155707609 |
| Molecular Formula | C11H22KNO3 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate |
| SMILES | CC(C)(C)CC(=O)N1CCC(O)C1.C[O-].[K+] |
| InChI | InChI=1S/C10H19NO2.CH3O.K/c1-10(2,3)6-9(13)11-5-4-8(12)7-11;1-2;/h8,12H,4-7H2,1-3H3;1H3;/q;-1;+1 |
| InChIKey | ZLIVNFOLYRVLNC-UHFFFAOYSA-N |
| XLogP | -3.00 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | -3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate?
The IUPAC name of potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate (CID 155707609) is potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate.
What is the SMILES notation for potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate?
The canonical SMILES for potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate is CC(C)(C)CC(=O)N1CCC(O)C1.C[O-].[K+].
What is the InChIKey of potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate?
The InChIKey is ZLIVNFOLYRVLNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO2.CH3O.K/c1-10(2,3)6-9(13)11-5-4-8(12)7-11;1-2;/h8,12H,4-7H2,1-3H3;1H3;/q;-1;+1.
What are the key properties of potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate?
potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate has a molecular weight of 255.40 g/mol, XLogP of -3.00, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;1-(3-hydroxypyrrolidin-1-yl)-3,3-dimethylbutan-1-one;methanolate is sourced from PubChem (CID 155707609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).