C13H25NOP+ — CID 170976675
1-(4,4-dimethylpent-1-en-2-yl)pyrrolidin-3-ol;methyl(methylidyne)phosphanium (PubChem CID 170976675) has the molecular formula C13H25NOP+ and a molecular weight of 242.32 g/mol. Its IUPAC name is 1-(4,4-dimethylpent-1-en-2-yl)pyrrolidin-3-ol;methyl(methylidyne)phosphanium.
| Compound Name | 1-(4,4-dimethylpent-1-en-2-yl)pyrrolidin-3-ol;methyl(methylidyne)phosphanium |
|---|---|
| PubChem CID | 170976675 |
| Molecular Formula | C13H25NOP+ |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1-(4,4-dimethylpent-1-en-2-yl)pyrrolidin-3-ol;methyl(methylidyne)phosphanium |
| SMILES | C#[P+]C.C=C(CC(C)(C)C)N1CCC(O)C1 |
| InChI | InChI=1S/C11H21NO.C2H4P/c1-9(7-11(2,3)4)12-6-5-10(13)8-12;1-3-2/h10,13H,1,5-8H2,2-4H3;1H,2H3/q;+1 |
| InChIKey | XTHDDWMQZUJVMR-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|