C10H21N2O2P — CID 171105480
1-(1-aminooxyphosphanylidene-3,3-dimethylbutyl)pyrrolidin-3-ol (PubChem CID 171105480) has the molecular formula C10H21N2O2P and a molecular weight of 232.26 g/mol. Its IUPAC name is 1-(1-aminooxyphosphanylidene-3,3-dimethylbutyl)pyrrolidin-3-ol.
| Compound Name | 1-(1-aminooxyphosphanylidene-3,3-dimethylbutyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 171105480 |
| Molecular Formula | C10H21N2O2P |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.13 |
| IUPAC Name | 1-(1-aminooxyphosphanylidene-3,3-dimethylbutyl)pyrrolidin-3-ol |
| SMILES | CC(C)(C)C/C(=P\ON)N1CCC(O)C1 |
| InChI | InChI=1S/C10H21N2O2P/c1-10(2,3)6-9(15-14-11)12-5-4-8(13)7-12/h8,13H,4-7,11H2,1-3H3 |
| InChIKey | IGWMOQXHIXMXJD-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|