C18H27N3O — CID 162838744
2-phenyl-1-(6,6,8-trimethyl-1,3,4,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)ethanone (PubChem CID 162838744) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is 2-phenyl-1-(6,6,8-trimethyl-1,3,4,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)ethanone.
| Compound Name | 2-phenyl-1-(6,6,8-trimethyl-1,3,4,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)ethanone |
|---|---|
| PubChem CID | 162838744 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | 2-phenyl-1-(6,6,8-trimethyl-1,3,4,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)ethanone |
| SMILES | CN1CC2CN(C(=O)Cc3ccccc3)CCN2C(C)(C)C1 |
| InChI | InChI=1S/C18H27N3O/c1-18(2)14-19(3)12-16-13-20(9-10-21(16)18)17(22)11-15-7-5-4-6-8-15/h4-8,16H,9-14H2,1-3H3 |
| InChIKey | CGXMQVNJDVDTNN-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |