C23H36N4O — CID 124877794
(9aS)-N-benzyl-8-cyclohexyl-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide (PubChem CID 124877794) has the molecular formula C23H36N4O and a molecular weight of 384.57 g/mol. Its IUPAC name is (9aS)-N-benzyl-8-cyclohexyl-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide.
| Compound Name | (9aS)-N-benzyl-8-cyclohexyl-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 124877794 |
| Molecular Formula | C23H36N4O |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.29 |
| IUPAC Name | (9aS)-N-benzyl-8-cyclohexyl-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazine-2-carboxamide |
| SMILES | CC1(C)CN(C(=O)NCc2ccccc2)C[C@@H]2CN(C3CCCCC3)CCN21 |
| InChI | InChI=1S/C23H36N4O/c1-23(2)18-26(22(28)24-15-19-9-5-3-6-10-19)17-21-16-25(13-14-27(21)23)20-11-7-4-8-12-20/h3,5-6,9-10,20-21H,4,7-8,11-18H2,1-2H3,(H,24,28)/t21-/m0/s1 |
| InChIKey | UYSWKXZQYLXNJN-NRFANRHFSA-N |
| XLogP | 3.31 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |