C22H32ClN3O — CID 162980604
(4-chlorophenyl)-(8-cyclohexyl-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)methanone (PubChem CID 162980604) has the molecular formula C22H32ClN3O and a molecular weight of 389.97 g/mol. Its IUPAC name is (4-chlorophenyl)-(8-cyclohexyl-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)methanone.
| Compound Name | (4-chlorophenyl)-(8-cyclohexyl-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)methanone |
|---|---|
| PubChem CID | 162980604 |
| Molecular Formula | C22H32ClN3O |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | (4-chlorophenyl)-(8-cyclohexyl-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-2-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2ccc(Cl)cc2)CC2CN(C3CCCCC3)CCN21 |
| InChI | InChI=1S/C22H32ClN3O/c1-22(2)16-25(21(27)17-8-10-18(23)11-9-17)15-20-14-24(12-13-26(20)22)19-6-4-3-5-7-19/h8-11,19-20H,3-7,12-16H2,1-2H3 |
| InChIKey | CZUDMPHTFVVCML-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |