C19H26ClN3O4 — CID 125418288
1-[(4S,9aR)-2-(4-chlorobenzoyl)-4-(hydroxymethyl)-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-2-methoxyethanone (PubChem CID 125418288) has the molecular formula C19H26ClN3O4 and a molecular weight of 395.89 g/mol. Its IUPAC name is 1-[(4S,9aR)-2-(4-chlorobenzoyl)-4-(hydroxymethyl)-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-2-methoxyethanone.
| Compound Name | 1-[(4S,9aR)-2-(4-chlorobenzoyl)-4-(hydroxymethyl)-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 125418288 |
| Molecular Formula | C19H26ClN3O4 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 1-[(4S,9aR)-2-(4-chlorobenzoyl)-4-(hydroxymethyl)-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCN2[C@@H](C1)CN(C(=O)c1ccc(Cl)cc1)C[C@@]2(C)CO |
| InChI | InChI=1S/C19H26ClN3O4/c1-19(13-24)12-22(18(26)14-3-5-15(20)6-4-14)10-16-9-21(7-8-23(16)19)17(25)11-27-2/h3-6,16,24H,7-13H2,1-2H3/t16-,19-/m0/s1 |
| InChIKey | QVACUICTWCILKX-LPHOPBHVSA-N |
| XLogP | 0.71 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |