C24H31N3O3 — CID 162937504
1-[2-benzyl-4-(hydroxymethyl)-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-2-phenoxyethanone (PubChem CID 162937504) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[2-benzyl-4-(hydroxymethyl)-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-2-phenoxyethanone.
| Compound Name | 1-[2-benzyl-4-(hydroxymethyl)-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 162937504 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 1-[2-benzyl-4-(hydroxymethyl)-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-2-phenoxyethanone |
| SMILES | CC1(CO)CN(Cc2ccccc2)CC2CN(C(=O)COc3ccccc3)CCN21 |
| InChI | InChI=1S/C24H31N3O3/c1-24(19-28)18-25(14-20-8-4-2-5-9-20)15-21-16-26(12-13-27(21)24)23(29)17-30-22-10-6-3-7-11-22/h2-11,21,28H,12-19H2,1H3 |
| InChIKey | FJZVUUUTQUZGHA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |