C26H35N3O2 — CID 124873323
1-[(9aR)-2-[(4-methoxyphenyl)methyl]-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-3-phenylpropan-1-one (PubChem CID 124873323) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is 1-[(9aR)-2-[(4-methoxyphenyl)methyl]-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-3-phenylpropan-1-one.
| Compound Name | 1-[(9aR)-2-[(4-methoxyphenyl)methyl]-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 124873323 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | 1-[(9aR)-2-[(4-methoxyphenyl)methyl]-4,4-dimethyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-3-phenylpropan-1-one |
| SMILES | COc1ccc(CN2C[C@@H]3CN(C(=O)CCc4ccccc4)CCN3C(C)(C)C2)cc1 |
| InChI | InChI=1S/C26H35N3O2/c1-26(2)20-27(17-22-9-12-24(31-3)13-10-22)18-23-19-28(15-16-29(23)26)25(30)14-11-21-7-5-4-6-8-21/h4-10,12-13,23H,11,14-20H2,1-3H3/t23-/m1/s1 |
| InChIKey | ASAAVQAKEYWUGZ-HSZRJFAPSA-N |
| XLogP | 3.43 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |