C22H30N4O — CID 124877798
[(4S,9aS)-2-benzyl-4-methyl-8-(pyridin-3-ylmethyl)-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-yl]methanol (PubChem CID 124877798) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is [(4S,9aS)-2-benzyl-4-methyl-8-(pyridin-3-ylmethyl)-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-yl]methanol.
| Compound Name | [(4S,9aS)-2-benzyl-4-methyl-8-(pyridin-3-ylmethyl)-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-yl]methanol |
|---|---|
| PubChem CID | 124877798 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | [(4S,9aS)-2-benzyl-4-methyl-8-(pyridin-3-ylmethyl)-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-yl]methanol |
| SMILES | C[C@@]1(CO)CN(Cc2ccccc2)C[C@@H]2CN(Cc3cccnc3)CCN21 |
| InChI | InChI=1S/C22H30N4O/c1-22(18-27)17-25(13-19-6-3-2-4-7-19)16-21-15-24(10-11-26(21)22)14-20-8-5-9-23-12-20/h2-9,12,21,27H,10-11,13-18H2,1H3/t21-,22-/m0/s1 |
| InChIKey | VAMGNXYRRATOAV-VXKWHMMOSA-N |
| XLogP | 1.83 |
| TPSA | 42.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |