C22H35N3O — CID 124877955
[(4S,9aR)-2-benzyl-8-cyclohexyl-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-yl]methanol (PubChem CID 124877955) has the molecular formula C22H35N3O and a molecular weight of 357.54 g/mol. Its IUPAC name is [(4S,9aR)-2-benzyl-8-cyclohexyl-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-yl]methanol.
| Compound Name | [(4S,9aR)-2-benzyl-8-cyclohexyl-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-yl]methanol |
|---|---|
| PubChem CID | 124877955 |
| Molecular Formula | C22H35N3O |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.28 |
| IUPAC Name | [(4S,9aR)-2-benzyl-8-cyclohexyl-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-4-yl]methanol |
| SMILES | C[C@@]1(CO)CN(Cc2ccccc2)C[C@@H]2CN(C3CCCCC3)CCN21 |
| InChI | InChI=1S/C22H35N3O/c1-22(18-26)17-23(14-19-8-4-2-5-9-19)15-21-16-24(12-13-25(21)22)20-10-6-3-7-11-20/h2,4-5,8-9,20-21,26H,3,6-7,10-18H2,1H3/t21-,22+/m1/s1 |
| InChIKey | VWNYOBZHWDCYFB-YADHBBJMSA-N |
| XLogP | 2.57 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |