C22H33N3O3 — CID 124877365
[(4S,9aR)-2-benzyl-4-(hydroxymethyl)-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-(oxan-4-yl)methanone (PubChem CID 124877365) has the molecular formula C22H33N3O3 and a molecular weight of 387.52 g/mol. Its IUPAC name is [(4S,9aR)-2-benzyl-4-(hydroxymethyl)-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-(oxan-4-yl)methanone.
| Compound Name | [(4S,9aR)-2-benzyl-4-(hydroxymethyl)-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-(oxan-4-yl)methanone |
|---|---|
| PubChem CID | 124877365 |
| Molecular Formula | C22H33N3O3 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.25 |
| IUPAC Name | [(4S,9aR)-2-benzyl-4-(hydroxymethyl)-4-methyl-1,3,6,7,9,9a-hexahydropyrazino[1,2-a]pyrazin-8-yl]-(oxan-4-yl)methanone |
| SMILES | C[C@@]1(CO)CN(Cc2ccccc2)C[C@@H]2CN(C(=O)C3CCOCC3)CCN21 |
| InChI | InChI=1S/C22H33N3O3/c1-22(17-26)16-23(13-18-5-3-2-4-6-18)14-20-15-24(9-10-25(20)22)21(27)19-7-11-28-12-8-19/h2-6,19-20,26H,7-17H2,1H3/t20-,22+/m1/s1 |
| InChIKey | RYAPCKHBFIHLRO-IRLDBZIGSA-N |
| XLogP | 1.19 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |