C13H20N2O — CID 114510870
3-ethyl-1-(pyridin-3-ylmethyl)piperidin-4-ol (PubChem CID 114510870) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is 3-ethyl-1-(pyridin-3-ylmethyl)piperidin-4-ol.
| Compound Name | 3-ethyl-1-(pyridin-3-ylmethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 114510870 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | 3-ethyl-1-(pyridin-3-ylmethyl)piperidin-4-ol |
| SMILES | CCC1CN(Cc2cccnc2)CCC1O |
| InChI | InChI=1S/C13H20N2O/c1-2-12-10-15(7-5-13(12)16)9-11-4-3-6-14-8-11/h3-4,6,8,12-13,16H,2,5,7,9-10H2,1H3 |
| InChIKey | VDNPTBBHDPVBTQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |