C13H22ClN3 — CID 17245035
2-[1-(pyridin-3-ylmethyl)piperidin-4-yl]ethanamine;hydrochloride (PubChem CID 17245035) has the molecular formula C13H22ClN3 and a molecular weight of 255.79 g/mol. Its IUPAC name is 2-[1-(pyridin-3-ylmethyl)piperidin-4-yl]ethanamine;hydrochloride.
| Compound Name | 2-[1-(pyridin-3-ylmethyl)piperidin-4-yl]ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17245035 |
| Molecular Formula | C13H22ClN3 |
| Molecular Weight | 255.79 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | 2-[1-(pyridin-3-ylmethyl)piperidin-4-yl]ethanamine;hydrochloride |
| SMILES | Cl.NCCC1CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C13H21N3.ClH/c14-6-3-12-4-8-16(9-5-12)11-13-2-1-7-15-10-13;/h1-2,7,10,12H,3-6,8-9,11,14H2;1H |
| InChIKey | MDMWIFJODBVASH-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.79 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |