C17H19FN2 — CID 16674606
3-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyridine (PubChem CID 16674606) has the molecular formula C17H19FN2 and a molecular weight of 270.35 g/mol. Its IUPAC name is 3-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyridine.
| Compound Name | 3-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyridine |
|---|---|
| PubChem CID | 16674606 |
| Molecular Formula | C17H19FN2 |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 3-[[4-(4-fluorophenyl)piperidin-1-yl]methyl]pyridine |
| SMILES | Fc1ccc(C2CCN(Cc3cccnc3)CC2)cc1 |
| InChI | InChI=1S/C17H19FN2/c18-17-5-3-15(4-6-17)16-7-10-20(11-8-16)13-14-2-1-9-19-12-14/h1-6,9,12,16H,7-8,10-11,13H2 |
| InChIKey | XURLKIVSAQCQLY-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |