C11H14F2N2 — CID 117007748
3-[(4,4-difluoropiperidin-1-yl)methyl]pyridine (PubChem CID 117007748) has the molecular formula C11H14F2N2 and a molecular weight of 212.24 g/mol. Its IUPAC name is 3-[(4,4-difluoropiperidin-1-yl)methyl]pyridine.
| Compound Name | 3-[(4,4-difluoropiperidin-1-yl)methyl]pyridine |
|---|---|
| PubChem CID | 117007748 |
| Molecular Formula | C11H14F2N2 |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 3-[(4,4-difluoropiperidin-1-yl)methyl]pyridine |
| SMILES | FC1(F)CCN(Cc2cccnc2)CC1 |
| InChI | InChI=1S/C11H14F2N2/c12-11(13)3-6-15(7-4-11)9-10-2-1-5-14-8-10/h1-2,5,8H,3-4,6-7,9H2 |
| InChIKey | JDFWMOSBFKIZNU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |