C12H16F2N2 — CID 143579558
5-[(4,4-difluoropiperidin-1-yl)methyl]-2-methylpyridine (PubChem CID 143579558) has the molecular formula C12H16F2N2 and a molecular weight of 226.27 g/mol. Its IUPAC name is 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-methylpyridine.
| Compound Name | 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-methylpyridine |
|---|---|
| PubChem CID | 143579558 |
| Molecular Formula | C12H16F2N2 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 5-[(4,4-difluoropiperidin-1-yl)methyl]-2-methylpyridine |
| SMILES | Cc1ccc(CN2CCC(F)(F)CC2)cn1 |
| InChI | InChI=1S/C12H16F2N2/c1-10-2-3-11(8-15-10)9-16-6-4-12(13,14)5-7-16/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | NHUNDINIPNHXKV-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |