C12H14F3N — CID 58243431
4,4-difluoro-1-[(4-fluorophenyl)methyl]piperidine (PubChem CID 58243431) has the molecular formula C12H14F3N and a molecular weight of 229.25 g/mol. Its IUPAC name is 4,4-difluoro-1-[(4-fluorophenyl)methyl]piperidine.
| Compound Name | 4,4-difluoro-1-[(4-fluorophenyl)methyl]piperidine |
|---|---|
| PubChem CID | 58243431 |
| Molecular Formula | C12H14F3N |
| Molecular Weight | 229.25 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 4,4-difluoro-1-[(4-fluorophenyl)methyl]piperidine |
| SMILES | Fc1ccc(CN2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C12H14F3N/c13-11-3-1-10(2-4-11)9-16-7-5-12(14,15)6-8-16/h1-4H,5-9H2 |
| InChIKey | VZYLQGCBTAFIHN-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.25 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |