C12H16BF2NO3 — CID 175501708
[4-[(4,4-difluoropiperidin-1-yl)methyl]phenoxy]boronic acid (PubChem CID 175501708) has the molecular formula C12H16BF2NO3 and a molecular weight of 271.07 g/mol. Its IUPAC name is [4-[(4,4-difluoropiperidin-1-yl)methyl]phenoxy]boronic acid.
| Compound Name | [4-[(4,4-difluoropiperidin-1-yl)methyl]phenoxy]boronic acid |
|---|---|
| PubChem CID | 175501708 |
| Molecular Formula | C12H16BF2NO3 |
| Molecular Weight | 271.07 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | [4-[(4,4-difluoropiperidin-1-yl)methyl]phenoxy]boronic acid |
| SMILES | OB(O)Oc1ccc(CN2CCC(F)(F)CC2)cc1 |
| InChI | InChI=1S/C12H16BF2NO3/c14-12(15)5-7-16(8-6-12)9-10-1-3-11(4-2-10)19-13(17)18/h1-4,17-18H,5-9H2 |
| InChIKey | VSSVJEZOBDGCPA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.07 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|