C15H19F2NO3 — CID 99952667
(2R)-2-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenoxy]propanoic acid (PubChem CID 99952667) has the molecular formula C15H19F2NO3 and a molecular weight of 299.32 g/mol. Its IUPAC name is (2R)-2-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 99952667 |
| Molecular Formula | C15H19F2NO3 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | (2R)-2-[4-[(4,4-difluoropiperidin-1-yl)methyl]phenoxy]propanoic acid |
| SMILES | C[C@@H](Oc1ccc(CN2CCC(F)(F)CC2)cc1)C(=O)O |
| InChI | InChI=1S/C15H19F2NO3/c1-11(14(19)20)21-13-4-2-12(3-5-13)10-18-8-6-15(16,17)7-9-18/h2-5,11H,6-10H2,1H3,(H,19,20)/t11-/m1/s1 |
| InChIKey | RUIHUSKMTIWSTD-LLVKDONJSA-N |
| XLogP | 2.77 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |