C18H25F2NO2 — CID 77098042
4,4-difluoro-1-[[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]methyl]piperidine (PubChem CID 77098042) has the molecular formula C18H25F2NO2 and a molecular weight of 325.40 g/mol. Its IUPAC name is 4,4-difluoro-1-[[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]methyl]piperidine.
| Compound Name | 4,4-difluoro-1-[[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 77098042 |
| Molecular Formula | C18H25F2NO2 |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 4,4-difluoro-1-[[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]methyl]piperidine |
| SMILES | COc1cc(CN2CCC(F)(F)CC2)ccc1OCC=C(C)C |
| InChI | InChI=1S/C18H25F2NO2/c1-14(2)6-11-23-16-5-4-15(12-17(16)22-3)13-21-9-7-18(19,20)8-10-21/h4-6,12H,7-11,13H2,1-3H3 |
| InChIKey | IBOYXOWYCMGFNL-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|