C18H27NO4 — CID 99936916
[(3S)-4-[[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]methyl]morpholin-3-yl]methanol (PubChem CID 99936916) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is [(3S)-4-[[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]methyl]morpholin-3-yl]methanol.
| Compound Name | [(3S)-4-[[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]methyl]morpholin-3-yl]methanol |
|---|---|
| PubChem CID | 99936916 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | [(3S)-4-[[3-methoxy-4-(3-methylbut-2-enoxy)phenyl]methyl]morpholin-3-yl]methanol |
| SMILES | COc1cc(CN2CCOC[C@@H]2CO)ccc1OCC=C(C)C |
| InChI | InChI=1S/C18H27NO4/c1-14(2)6-8-23-17-5-4-15(10-18(17)21-3)11-19-7-9-22-13-16(19)12-20/h4-6,10,16,20H,7-9,11-13H2,1-3H3/t16-/m0/s1 |
| InChIKey | OUCKNRQGYULHCA-INIZCTEOSA-N |
| XLogP | 2.23 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|