C13H18ClNO3 — CID 99930605
[(3S)-4-[(3-chloro-4-methoxyphenyl)methyl]morpholin-3-yl]methanol (PubChem CID 99930605) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is [(3S)-4-[(3-chloro-4-methoxyphenyl)methyl]morpholin-3-yl]methanol.
| Compound Name | [(3S)-4-[(3-chloro-4-methoxyphenyl)methyl]morpholin-3-yl]methanol |
|---|---|
| PubChem CID | 99930605 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | [(3S)-4-[(3-chloro-4-methoxyphenyl)methyl]morpholin-3-yl]methanol |
| SMILES | COc1ccc(CN2CCOC[C@@H]2CO)cc1Cl |
| InChI | InChI=1S/C13H18ClNO3/c1-17-13-3-2-10(6-12(13)14)7-15-4-5-18-9-11(15)8-16/h2-3,6,11,16H,4-5,7-9H2,1H3/t11-/m0/s1 |
| InChIKey | QBRGHOBYBBNHMD-NSHDSACASA-N |
| XLogP | 1.54 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |