C16H24ClNO4 — CID 99935125
[(3R)-4-[(2-chloro-5-methoxy-4-propoxyphenyl)methyl]morpholin-3-yl]methanol (PubChem CID 99935125) has the molecular formula C16H24ClNO4 and a molecular weight of 329.82 g/mol. Its IUPAC name is [(3R)-4-[(2-chloro-5-methoxy-4-propoxyphenyl)methyl]morpholin-3-yl]methanol.
| Compound Name | [(3R)-4-[(2-chloro-5-methoxy-4-propoxyphenyl)methyl]morpholin-3-yl]methanol |
|---|---|
| PubChem CID | 99935125 |
| Molecular Formula | C16H24ClNO4 |
| Molecular Weight | 329.82 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | [(3R)-4-[(2-chloro-5-methoxy-4-propoxyphenyl)methyl]morpholin-3-yl]methanol |
| SMILES | CCCOc1cc(Cl)c(CN2CCOC[C@H]2CO)cc1OC |
| InChI | InChI=1S/C16H24ClNO4/c1-3-5-22-16-8-14(17)12(7-15(16)20-2)9-18-4-6-21-11-13(18)10-19/h7-8,13,19H,3-6,9-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | ZTIBWZFZJDUCRG-CYBMUJFWSA-N |
| XLogP | 2.33 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.82 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |