C12H16ClNO3 — CID 117009222
[4-(5-chloro-2-methoxyphenyl)morpholin-3-yl]methanol (PubChem CID 117009222) has the molecular formula C12H16ClNO3 and a molecular weight of 257.72 g/mol. Its IUPAC name is [4-(5-chloro-2-methoxyphenyl)morpholin-3-yl]methanol.
| Compound Name | [4-(5-chloro-2-methoxyphenyl)morpholin-3-yl]methanol |
|---|---|
| PubChem CID | 117009222 |
| Molecular Formula | C12H16ClNO3 |
| Molecular Weight | 257.72 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | [4-(5-chloro-2-methoxyphenyl)morpholin-3-yl]methanol |
| SMILES | COc1ccc(Cl)cc1N1CCOCC1CO |
| InChI | InChI=1S/C12H16ClNO3/c1-16-12-3-2-9(13)6-11(12)14-4-5-17-8-10(14)7-15/h2-3,6,10,15H,4-5,7-8H2,1H3 |
| InChIKey | MITZPGNPOUJDPC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.72 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |