C24H36F2N2O3 — CID 175646314
1-[5-[[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-2-methoxyphenoxy]-3-(4,4-difluoropiperidin-1-yl)propan-2-ol (PubChem CID 175646314) has the molecular formula C24H36F2N2O3 and a molecular weight of 438.56 g/mol. Its IUPAC name is 1-[5-[[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-2-methoxyphenoxy]-3-(4,4-difluoropiperidin-1-yl)propan-2-ol.
| Compound Name | 1-[5-[[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-2-methoxyphenoxy]-3-(4,4-difluoropiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 175646314 |
| Molecular Formula | C24H36F2N2O3 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 1-[5-[[(3aR,7aS)-1,3,3a,4,5,6,7,7a-octahydroisoindol-2-yl]methyl]-2-methoxyphenoxy]-3-(4,4-difluoropiperidin-1-yl)propan-2-ol |
| SMILES | COc1ccc(CN2C[C@H]3CCCC[C@H]3C2)cc1OCC(O)CN1CCC(F)(F)CC1 |
| InChI | InChI=1S/C24H36F2N2O3/c1-30-22-7-6-18(13-28-14-19-4-2-3-5-20(19)15-28)12-23(22)31-17-21(29)16-27-10-8-24(25,26)9-11-27/h6-7,12,19-21,29H,2-5,8-11,13-17H2,1H3/t19-,20+,21? |
| InChIKey | UNVMCDNCGWWXSF-WCRBZPEASA-N |
| XLogP | 3.79 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |