C22H36N2O4 — CID 97276509
1-[(2S)-3-[4-(azepan-1-ylmethyl)-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol (PubChem CID 97276509) has the molecular formula C22H36N2O4 and a molecular weight of 392.54 g/mol. Its IUPAC name is 1-[(2S)-3-[4-(azepan-1-ylmethyl)-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol.
| Compound Name | 1-[(2S)-3-[4-(azepan-1-ylmethyl)-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol |
|---|---|
| PubChem CID | 97276509 |
| Molecular Formula | C22H36N2O4 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | 1-[(2S)-3-[4-(azepan-1-ylmethyl)-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol |
| SMILES | COc1cc(CN2CCCCCC2)ccc1OC[C@@H](O)CN1CCC(O)CC1 |
| InChI | InChI=1S/C22H36N2O4/c1-27-22-14-18(15-23-10-4-2-3-5-11-23)6-7-21(22)28-17-20(26)16-24-12-8-19(25)9-13-24/h6-7,14,19-20,25-26H,2-5,8-13,15-17H2,1H3/t20-/m0/s1 |
| InChIKey | QSEYHUGWQCUNGK-FQEVSTJZSA-N |
| XLogP | 2.27 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |