C21H33FN2O4 — CID 72869940
1-[3-[4-[(4-fluoropiperidin-1-yl)methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol (PubChem CID 72869940) has the molecular formula C21H33FN2O4 and a molecular weight of 396.50 g/mol. Its IUPAC name is 1-[3-[4-[(4-fluoropiperidin-1-yl)methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol.
| Compound Name | 1-[3-[4-[(4-fluoropiperidin-1-yl)methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol |
|---|---|
| PubChem CID | 72869940 |
| Molecular Formula | C21H33FN2O4 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 1-[3-[4-[(4-fluoropiperidin-1-yl)methyl]-2-methoxyphenoxy]-2-hydroxypropyl]piperidin-4-ol |
| SMILES | COc1cc(CN2CCC(F)CC2)ccc1OCC(O)CN1CCC(O)CC1 |
| InChI | InChI=1S/C21H33FN2O4/c1-27-21-12-16(13-23-8-4-17(22)5-9-23)2-3-20(21)28-15-19(26)14-24-10-6-18(25)7-11-24/h2-3,12,17-19,25-26H,4-11,13-15H2,1H3 |
| InChIKey | XUAWZUIOXICIAL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |