C21H34N2O4 — CID 72853462
1-[2-methoxy-4-[(4-methylpiperidin-1-yl)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol (PubChem CID 72853462) has the molecular formula C21H34N2O4 and a molecular weight of 378.51 g/mol. Its IUPAC name is 1-[2-methoxy-4-[(4-methylpiperidin-1-yl)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[2-methoxy-4-[(4-methylpiperidin-1-yl)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 72853462 |
| Molecular Formula | C21H34N2O4 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 1-[2-methoxy-4-[(4-methylpiperidin-1-yl)methyl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
| SMILES | COc1cc(CN2CCC(C)CC2)ccc1OCC(O)CN1CCOCC1 |
| InChI | InChI=1S/C21H34N2O4/c1-17-5-7-22(8-6-17)14-18-3-4-20(21(13-18)25-2)27-16-19(24)15-23-9-11-26-12-10-23/h3-4,13,17,19,24H,5-12,14-16H2,1-2H3 |
| InChIKey | JQQRNKUOASZKQS-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 54.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |