C17H28N2O4 — CID 45240559
1-[4-(ethylaminomethyl)-2-methoxyphenoxy]-3-morpholin-4-ylpropan-2-ol (PubChem CID 45240559) has the molecular formula C17H28N2O4 and a molecular weight of 324.42 g/mol. Its IUPAC name is 1-[4-(ethylaminomethyl)-2-methoxyphenoxy]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[4-(ethylaminomethyl)-2-methoxyphenoxy]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 45240559 |
| Molecular Formula | C17H28N2O4 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-[4-(ethylaminomethyl)-2-methoxyphenoxy]-3-morpholin-4-ylpropan-2-ol |
| SMILES | CCNCc1ccc(OCC(O)CN2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C17H28N2O4/c1-3-18-11-14-4-5-16(17(10-14)21-2)23-13-15(20)12-19-6-8-22-9-7-19/h4-5,10,15,18,20H,3,6-9,11-13H2,1-2H3 |
| InChIKey | HQGNRFNXIXHRJM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |