C23H31ClN2O4 — CID 45230545
1-[4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-morpholin-4-ylpropan-2-ol (PubChem CID 45230545) has the molecular formula C23H31ClN2O4 and a molecular weight of 434.96 g/mol. Its IUPAC name is 1-[4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 45230545 |
| Molecular Formula | C23H31ClN2O4 |
| Molecular Weight | 434.96 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 1-[4-[[2-(4-chlorophenyl)ethylamino]methyl]-2-methoxyphenoxy]-3-morpholin-4-ylpropan-2-ol |
| SMILES | COc1cc(CNCCc2ccc(Cl)cc2)ccc1OCC(O)CN1CCOCC1 |
| InChI | InChI=1S/C23H31ClN2O4/c1-28-23-14-19(15-25-9-8-18-2-5-20(24)6-3-18)4-7-22(23)30-17-21(27)16-26-10-12-29-13-11-26/h2-7,14,21,25,27H,8-13,15-17H2,1H3 |
| InChIKey | VCWNFTDKGCMVMI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.96 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|