C25H37N3O3 — CID 25275251
(2S)-1-(azocan-1-yl)-3-[2-methoxy-4-[(2-pyridin-4-ylethylamino)methyl]phenoxy]propan-2-ol (PubChem CID 25275251) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is (2S)-1-(azocan-1-yl)-3-[2-methoxy-4-[(2-pyridin-4-ylethylamino)methyl]phenoxy]propan-2-ol.
| Compound Name | (2S)-1-(azocan-1-yl)-3-[2-methoxy-4-[(2-pyridin-4-ylethylamino)methyl]phenoxy]propan-2-ol |
|---|---|
| PubChem CID | 25275251 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | (2S)-1-(azocan-1-yl)-3-[2-methoxy-4-[(2-pyridin-4-ylethylamino)methyl]phenoxy]propan-2-ol |
| SMILES | COc1cc(CNCCc2ccncc2)ccc1OC[C@@H](O)CN1CCCCCCC1 |
| InChI | InChI=1S/C25H37N3O3/c1-30-25-17-22(18-27-14-11-21-9-12-26-13-10-21)7-8-24(25)31-20-23(29)19-28-15-5-3-2-4-6-16-28/h7-10,12-13,17,23,27,29H,2-6,11,14-16,18-20H2,1H3/t23-/m0/s1 |
| InChIKey | BIUCWEKYXJVDDO-QHCPKHFHSA-N |
| XLogP | 3.43 |
| TPSA | 66.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|